C20H31NO3S — CID 101365461
N-[(E)-3-(1-hydroxyethyl)oct-2-enyl]-4-methyl-N-prop-2-enylbenzenesulfonamide (PubChem CID 101365461) has the molecular formula C20H31NO3S and a molecular weight of 365.54 g/mol. Its IUPAC name is N-[(E)-3-(1-hydroxyethyl)oct-2-enyl]-4-methyl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-[(E)-3-(1-hydroxyethyl)oct-2-enyl]-4-methyl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 101365461 |
| Molecular Formula | C20H31NO3S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N-[(E)-3-(1-hydroxyethyl)oct-2-enyl]-4-methyl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(C/C=C(\CCCCC)C(C)O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H31NO3S/c1-5-7-8-9-19(18(4)22)14-16-21(15-6-2)25(23,24)20-12-10-17(3)11-13-20/h6,10-14,18,22H,2,5,7-9,15-16H2,1,3-4H3/b19-14+ |
| InChIKey | IACKJAITUCPHGJ-XMHGGMMESA-N |
| XLogP | 4.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|