C28H47NO5S — CID 172518125
4-methyl-N-prop-2-enyl-N-[(2S,3S,4R)-2,3,4-tributoxyhex-5-enyl]benzenesulfonamide (PubChem CID 172518125) has the molecular formula C28H47NO5S and a molecular weight of 509.75 g/mol. Its IUPAC name is 4-methyl-N-prop-2-enyl-N-[(2S,3S,4R)-2,3,4-tributoxyhex-5-enyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-prop-2-enyl-N-[(2S,3S,4R)-2,3,4-tributoxyhex-5-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 172518125 |
| Molecular Formula | C28H47NO5S |
| Molecular Weight | 509.75 g/mol |
| Exact Mass | 509.32 |
| IUPAC Name | 4-methyl-N-prop-2-enyl-N-[(2S,3S,4R)-2,3,4-tributoxyhex-5-enyl]benzenesulfonamide |
| SMILES | C=CCN(C[C@H](OCCCC)[C@@H](OCCCC)[C@@H](C=C)OCCCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H47NO5S/c1-7-12-20-32-26(11-5)28(34-22-14-9-3)27(33-21-13-8-2)23-29(19-10-4)35(30,31)25-17-15-24(6)16-18-25/h10-11,15-18,26-28H,4-5,7-9,12-14,19-23H2,1-3,6H3/t26-,27+,28+/m1/s1 |
| InChIKey | NWVUQUKIOMPNRF-PKTNWEFCSA-N |
| XLogP | 5.91 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.75 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|