C22H31NO3S — CID 12062498
4-methyl-N-[[(2R,3S)-3-methyl-3-oct-1-ynyloxiran-2-yl]methyl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 12062498) has the molecular formula C22H31NO3S and a molecular weight of 389.56 g/mol. Its IUPAC name is 4-methyl-N-[[(2R,3S)-3-methyl-3-oct-1-ynyloxiran-2-yl]methyl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-methyl-N-[[(2R,3S)-3-methyl-3-oct-1-ynyloxiran-2-yl]methyl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 12062498 |
| Molecular Formula | C22H31NO3S |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 4-methyl-N-[[(2R,3S)-3-methyl-3-oct-1-ynyloxiran-2-yl]methyl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(C[C@H]1O[C@@]1(C)C#CCCCCCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H31NO3S/c1-5-7-8-9-10-11-16-22(4)21(26-22)18-23(17-6-2)27(24,25)20-14-12-19(3)13-15-20/h6,12-15,21H,2,5,7-10,17-18H2,1,3-4H3/t21-,22+/m1/s1 |
| InChIKey | DPRURLHLDLLMJO-YADHBBJMSA-N |
| XLogP | 4.30 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|