C19H31NO3SSi — CID 102473274
N-[(2R,3R)-2-hydroxy-3-(trimethylsilylmethyl)pent-4-enyl]-4-methyl-N-prop-2-enylbenzenesulfonamide (PubChem CID 102473274) has the molecular formula C19H31NO3SSi and a molecular weight of 381.61 g/mol. Its IUPAC name is N-[(2R,3R)-2-hydroxy-3-(trimethylsilylmethyl)pent-4-enyl]-4-methyl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-[(2R,3R)-2-hydroxy-3-(trimethylsilylmethyl)pent-4-enyl]-4-methyl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 102473274 |
| Molecular Formula | C19H31NO3SSi |
| Molecular Weight | 381.61 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-[(2R,3R)-2-hydroxy-3-(trimethylsilylmethyl)pent-4-enyl]-4-methyl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(C[C@H](O)[C@@H](C=C)C[Si](C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H31NO3SSi/c1-7-13-20(14-19(21)17(8-2)15-25(4,5)6)24(22,23)18-11-9-16(3)10-12-18/h7-12,17,19,21H,1-2,13-15H2,3-6H3/t17-,19-/m0/s1 |
| InChIKey | FIQGWMWNVFUBSX-HKUYNNGSSA-N |
| XLogP | 3.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|