C34H32N2O2S2 — CID 23519861
[(2S,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidin-2-yl]methanamine (PubChem CID 23519861) has the molecular formula C34H32N2O2S2 and a molecular weight of 564.78 g/mol. Its IUPAC name is [(2S,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidin-2-yl]methanamine.
| Compound Name | [(2S,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 23519861 |
| Molecular Formula | C34H32N2O2S2 |
| Molecular Weight | 564.78 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | [(2S,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidin-2-yl]methanamine |
| SMILES | NC[C@@H]1C[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)CN1S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H32N2O2S2/c35-24-31-23-32(25-36(31)40(37,38)33-21-20-26-12-10-11-13-27(26)22-33)39-34(28-14-4-1-5-15-28,29-16-6-2-7-17-29)30-18-8-3-9-19-30/h1-22,31-32H,23-25,35H2/t31-,32+/m0/s1 |
| InChIKey | VEJVQMQMFOGCLS-AJQTZOPKSA-N |
| XLogP | 6.66 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.78 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|