C35H33NO5S3 — CID 86584832
[(2S,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidin-2-yl]methyl methanesulfonate (PubChem CID 86584832) has the molecular formula C35H33NO5S3 and a molecular weight of 643.85 g/mol. Its IUPAC name is [(2S,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidin-2-yl]methyl methanesulfonate.
| Compound Name | [(2S,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 86584832 |
| Molecular Formula | C35H33NO5S3 |
| Molecular Weight | 643.85 g/mol |
| Exact Mass | 643.15 |
| IUPAC Name | [(2S,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidin-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1C[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)CN1S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C35H33NO5S3/c1-43(37,38)41-26-32-24-33(25-36(32)44(39,40)34-22-21-27-13-11-12-14-28(27)23-34)42-35(29-15-5-2-6-16-29,30-17-7-3-8-18-30)31-19-9-4-10-20-31/h2-23,32-33H,24-26H2,1H3/t32-,33+/m0/s1 |
| InChIKey | IVMBNLUNZLCGCX-JHOUSYSJSA-N |
| XLogP | 6.67 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.85 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|