C35H33NO3S2 — CID 69433592
2-[(2R,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidin-2-yl]ethanol (PubChem CID 69433592) has the molecular formula C35H33NO3S2 and a molecular weight of 579.79 g/mol. Its IUPAC name is 2-[(2R,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidin-2-yl]ethanol.
| Compound Name | 2-[(2R,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidin-2-yl]ethanol |
|---|---|
| PubChem CID | 69433592 |
| Molecular Formula | C35H33NO3S2 |
| Molecular Weight | 579.79 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | 2-[(2R,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidin-2-yl]ethanol |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1C[C@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1CCO |
| InChI | InChI=1S/C35H33NO3S2/c37-23-22-32-25-33(26-36(32)41(38,39)34-21-20-27-12-10-11-13-28(27)24-34)40-35(29-14-4-1-5-15-29,30-16-6-2-7-17-30)31-18-8-3-9-19-31/h1-21,24,32-33,37H,22-23,25-26H2/t32-,33-/m1/s1 |
| InChIKey | ZZOJGAONSSMNKB-CZNDPXEESA-N |
| XLogP | 7.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.79 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|