C15H13NO5S — CID 70400393
(2S)-1-naphthalen-2-ylsulfonyl-3-oxopyrrolidine-2-carboxylic acid (PubChem CID 70400393) has the molecular formula C15H13NO5S and a molecular weight of 319.34 g/mol. Its IUPAC name is (2S)-1-naphthalen-2-ylsulfonyl-3-oxopyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-naphthalen-2-ylsulfonyl-3-oxopyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70400393 |
| Molecular Formula | C15H13NO5S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | (2S)-1-naphthalen-2-ylsulfonyl-3-oxopyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C(=O)CCN1S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H13NO5S/c17-13-7-8-16(14(13)15(18)19)22(20,21)12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,14H,7-8H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | IHKHIBSTZWYHRT-AWEZNQCLSA-N |
| XLogP | 1.26 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|