C44H39N3O3S2 — CID 70002482
(2S,4R)-N-benzyl-N-(2-cyanoethyl)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidine-2-carboxamide (PubChem CID 70002482) has the molecular formula C44H39N3O3S2 and a molecular weight of 721.95 g/mol. Its IUPAC name is (2S,4R)-N-benzyl-N-(2-cyanoethyl)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-benzyl-N-(2-cyanoethyl)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70002482 |
| Molecular Formula | C44H39N3O3S2 |
| Molecular Weight | 721.95 g/mol |
| Exact Mass | 721.24 |
| IUPAC Name | (2S,4R)-N-benzyl-N-(2-cyanoethyl)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidine-2-carboxamide |
| SMILES | N#CCCN(Cc1ccccc1)C(=O)[C@@H]1C[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)CN1S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C44H39N3O3S2/c45-28-15-29-46(32-34-16-5-1-6-17-34)43(48)42-31-40(33-47(42)52(49,50)41-27-26-35-18-13-14-19-36(35)30-41)51-44(37-20-7-2-8-21-37,38-22-9-3-10-23-38)39-24-11-4-12-25-39/h1-14,16-27,30,40,42H,15,29,31-33H2/t40-,42+/m1/s1 |
| InChIKey | ZCLTVSHXUKKVBN-AYTHJNNVSA-N |
| XLogP | 8.64 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.95 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|