C25H29NO6S2 — CID 90725845
[(3S,5S)-1-naphthalen-2-ylsulfonyl-5-(3-phenylpropoxymethyl)pyrrolidin-3-yl] methanesulfonate (PubChem CID 90725845) has the molecular formula C25H29NO6S2 and a molecular weight of 503.64 g/mol. Its IUPAC name is [(3S,5S)-1-naphthalen-2-ylsulfonyl-5-(3-phenylpropoxymethyl)pyrrolidin-3-yl] methanesulfonate.
| Compound Name | [(3S,5S)-1-naphthalen-2-ylsulfonyl-5-(3-phenylpropoxymethyl)pyrrolidin-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 90725845 |
| Molecular Formula | C25H29NO6S2 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | [(3S,5S)-1-naphthalen-2-ylsulfonyl-5-(3-phenylpropoxymethyl)pyrrolidin-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]1C[C@@H](COCCCc2ccccc2)N(S(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C25H29NO6S2/c1-33(27,28)32-24-17-23(19-31-15-7-10-20-8-3-2-4-9-20)26(18-24)34(29,30)25-14-13-21-11-5-6-12-22(21)16-25/h2-6,8-9,11-14,16,23-24H,7,10,15,17-19H2,1H3/t23-,24-/m0/s1 |
| InChIKey | MVQQQHAUIPQKNV-ZEQRLZLVSA-N |
| XLogP | 3.60 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|