C26H25N3O7S2 — CID 18618293
4-[[2-[(4-acetylsulfanyl-1-naphthalen-2-ylsulfonylpyrrolidine-2-carbonyl)amino]acetyl]amino]benzoic acid (PubChem CID 18618293) has the molecular formula C26H25N3O7S2 and a molecular weight of 555.63 g/mol. Its IUPAC name is 4-[[2-[(4-acetylsulfanyl-1-naphthalen-2-ylsulfonylpyrrolidine-2-carbonyl)amino]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[(4-acetylsulfanyl-1-naphthalen-2-ylsulfonylpyrrolidine-2-carbonyl)amino]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18618293 |
| Molecular Formula | C26H25N3O7S2 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | 4-[[2-[(4-acetylsulfanyl-1-naphthalen-2-ylsulfonylpyrrolidine-2-carbonyl)amino]acetyl]amino]benzoic acid |
| SMILES | CC(=O)SC1CC(C(=O)NCC(=O)Nc2ccc(C(=O)O)cc2)N(S(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C26H25N3O7S2/c1-16(30)37-21-13-23(25(32)27-14-24(31)28-20-9-6-18(7-10-20)26(33)34)29(15-21)38(35,36)22-11-8-17-4-2-3-5-19(17)12-22/h2-12,21,23H,13-15H2,1H3,(H,27,32)(H,28,31)(H,33,34) |
| InChIKey | JWBYZVHTHCRCTM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|