C15H29N3O5S — CID 166152566
tert-butyl 4-[1-(2-methylsulfonyloxyethyl)azetidin-3-yl]piperazine-1-carboxylate (PubChem CID 166152566) has the molecular formula C15H29N3O5S and a molecular weight of 363.48 g/mol. Its IUPAC name is tert-butyl 4-[1-(2-methylsulfonyloxyethyl)azetidin-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(2-methylsulfonyloxyethyl)azetidin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166152566 |
| Molecular Formula | C15H29N3O5S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | tert-butyl 4-[1-(2-methylsulfonyloxyethyl)azetidin-3-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2CN(CCOS(C)(=O)=O)C2)CC1 |
| InChI | InChI=1S/C15H29N3O5S/c1-15(2,3)23-14(19)18-7-5-17(6-8-18)13-11-16(12-13)9-10-22-24(4,20)21/h13H,5-12H2,1-4H3 |
| InChIKey | DPHVOPIOWOTSSU-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|