C17H31ClN2O4 — CID 176653560
tert-butyl 4-[1-[(2-chloroacetyl)amino]ethyl]-4-(3-hydroxypropyl)piperidine-1-carboxylate (PubChem CID 176653560) has the molecular formula C17H31ClN2O4 and a molecular weight of 362.90 g/mol. Its IUPAC name is tert-butyl 4-[1-[(2-chloroacetyl)amino]ethyl]-4-(3-hydroxypropyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[(2-chloroacetyl)amino]ethyl]-4-(3-hydroxypropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 176653560 |
| Molecular Formula | C17H31ClN2O4 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | tert-butyl 4-[1-[(2-chloroacetyl)amino]ethyl]-4-(3-hydroxypropyl)piperidine-1-carboxylate |
| SMILES | CC(NC(=O)CCl)C1(CCCO)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H31ClN2O4/c1-13(19-14(22)12-18)17(6-5-11-21)7-9-20(10-8-17)15(23)24-16(2,3)4/h13,21H,5-12H2,1-4H3,(H,19,22) |
| InChIKey | GZEVDZXCKQXYEJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|