C22H30N2O2S — CID 67082466
tert-butyl 4-[4-(3-cyano-4-methylsulfanylphenyl)but-3-enyl]piperidine-1-carboxylate (PubChem CID 67082466) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is tert-butyl 4-[4-(3-cyano-4-methylsulfanylphenyl)but-3-enyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(3-cyano-4-methylsulfanylphenyl)but-3-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67082466 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | tert-butyl 4-[4-(3-cyano-4-methylsulfanylphenyl)but-3-enyl]piperidine-1-carboxylate |
| SMILES | CSc1ccc(C=CCCC2CCN(C(=O)OC(C)(C)C)CC2)cc1C#N |
| InChI | InChI=1S/C22H30N2O2S/c1-22(2,3)26-21(25)24-13-11-17(12-14-24)7-5-6-8-18-9-10-20(27-4)19(15-18)16-23/h6,8-10,15,17H,5,7,11-14H2,1-4H3 |
| InChIKey | JHIVVOCVXHBLTA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |