C22H33NO2S — CID 67082504
tert-butyl 4-[4-(3,4-dimethyl-2-sulfanylphenyl)but-3-enyl]piperidine-1-carboxylate (PubChem CID 67082504) has the molecular formula C22H33NO2S and a molecular weight of 375.58 g/mol. Its IUPAC name is tert-butyl 4-[4-(3,4-dimethyl-2-sulfanylphenyl)but-3-enyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(3,4-dimethyl-2-sulfanylphenyl)but-3-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67082504 |
| Molecular Formula | C22H33NO2S |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | tert-butyl 4-[4-(3,4-dimethyl-2-sulfanylphenyl)but-3-enyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(C=CCCC2CCN(C(=O)OC(C)(C)C)CC2)c(S)c1C |
| InChI | InChI=1S/C22H33NO2S/c1-16-10-11-19(20(26)17(16)2)9-7-6-8-18-12-14-23(15-13-18)21(24)25-22(3,4)5/h7,9-11,18,26H,6,8,12-15H2,1-5H3 |
| InChIKey | XPDWCFDRALYNKX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|