C20H24N4O3 — CID 172914755
tert-butyl 3-[[4-(4-cyano-2-methoxyphenyl)pyrazol-1-yl]methyl]azetidine-1-carboxylate (PubChem CID 172914755) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is tert-butyl 3-[[4-(4-cyano-2-methoxyphenyl)pyrazol-1-yl]methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(4-cyano-2-methoxyphenyl)pyrazol-1-yl]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 172914755 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | tert-butyl 3-[[4-(4-cyano-2-methoxyphenyl)pyrazol-1-yl]methyl]azetidine-1-carboxylate |
| SMILES | COc1cc(C#N)ccc1-c1cnn(CC2CN(C(=O)OC(C)(C)C)C2)c1 |
| InChI | InChI=1S/C20H24N4O3/c1-20(2,3)27-19(25)23-10-15(11-23)12-24-13-16(9-22-24)17-6-5-14(8-21)7-18(17)26-4/h5-7,9,13,15H,10-12H2,1-4H3 |
| InChIKey | KSRAJGHJXPAEJP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |