C28H29ClN4O8 — CID 135384714
3-[3-chloro-4-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]phenoxy]-2-(1,3-dioxoisoindol-2-yl)oxypropanoic acid (PubChem CID 135384714) has the molecular formula C28H29ClN4O8 and a molecular weight of 585.01 g/mol. Its IUPAC name is 3-[3-chloro-4-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]phenoxy]-2-(1,3-dioxoisoindol-2-yl)oxypropanoic acid.
| Compound Name | 3-[3-chloro-4-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]phenoxy]-2-(1,3-dioxoisoindol-2-yl)oxypropanoic acid |
|---|---|
| PubChem CID | 135384714 |
| Molecular Formula | C28H29ClN4O8 |
| Molecular Weight | 585.01 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | 3-[3-chloro-4-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]phenoxy]-2-(1,3-dioxoisoindol-2-yl)oxypropanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCn1cc(-c2ccc(OCC(ON3C(=O)c4ccccc4C3=O)C(=O)O)cc2Cl)cn1 |
| InChI | InChI=1S/C28H29ClN4O8/c1-28(2,3)40-27(38)30-11-6-12-32-15-17(14-31-32)19-10-9-18(13-22(19)29)39-16-23(26(36)37)41-33-24(34)20-7-4-5-8-21(20)25(33)35/h4-5,7-10,13-15,23H,6,11-12,16H2,1-3H3,(H,30,38)(H,36,37) |
| InChIKey | BFQOXDWDYRAKMG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 149.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.01 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|