C26H36N2O6 — CID 129249946
tert-butyl 2-hydroxy-3-[4-[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-3-pyridinyl]phenoxy]propanoate (PubChem CID 129249946) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is tert-butyl 2-hydroxy-3-[4-[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-3-pyridinyl]phenoxy]propanoate.
| Compound Name | tert-butyl 2-hydroxy-3-[4-[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-3-pyridinyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 129249946 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | tert-butyl 2-hydroxy-3-[4-[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-3-pyridinyl]phenoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)NCCCc1ccc(-c2ccc(OCC(O)C(=O)OC(C)(C)C)cc2)cn1 |
| InChI | InChI=1S/C26H36N2O6/c1-25(2,3)33-23(30)22(29)17-32-21-13-10-18(11-14-21)19-9-12-20(28-16-19)8-7-15-27-24(31)34-26(4,5)6/h9-14,16,22,29H,7-8,15,17H2,1-6H3,(H,27,31) |
| InChIKey | AGPQRRSDAVXYLQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|