C19H23N5O2 — CID 174190296
6-[4-(8-methylquinoxalin-2-yl)pyrazol-1-yl]hexylcarbamic acid (PubChem CID 174190296) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 6-[4-(8-methylquinoxalin-2-yl)pyrazol-1-yl]hexylcarbamic acid.
| Compound Name | 6-[4-(8-methylquinoxalin-2-yl)pyrazol-1-yl]hexylcarbamic acid |
|---|---|
| PubChem CID | 174190296 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 6-[4-(8-methylquinoxalin-2-yl)pyrazol-1-yl]hexylcarbamic acid |
| SMILES | Cc1cccc2ncc(-c3cnn(CCCCCCNC(=O)O)c3)nc12 |
| InChI | InChI=1S/C19H23N5O2/c1-14-7-6-8-16-18(14)23-17(12-21-16)15-11-22-24(13-15)10-5-3-2-4-9-20-19(25)26/h6-8,11-13,20H,2-5,9-10H2,1H3,(H,25,26) |
| InChIKey | HXHMTJVQZKHFJS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|