C11H21N5O2 — CID 62843765
2-(4-aminopyrazol-1-yl)-N-[2-[2-methoxyethyl(methyl)amino]ethyl]acetamide (PubChem CID 62843765) has the molecular formula C11H21N5O2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-(4-aminopyrazol-1-yl)-N-[2-[2-methoxyethyl(methyl)amino]ethyl]acetamide.
| Compound Name | 2-(4-aminopyrazol-1-yl)-N-[2-[2-methoxyethyl(methyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 62843765 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 2-(4-aminopyrazol-1-yl)-N-[2-[2-methoxyethyl(methyl)amino]ethyl]acetamide |
| SMILES | COCCN(C)CCNC(=O)Cn1cc(N)cn1 |
| InChI | InChI=1S/C11H21N5O2/c1-15(5-6-18-2)4-3-13-11(17)9-16-8-10(12)7-14-16/h7-8H,3-6,9,12H2,1-2H3,(H,13,17) |
| InChIKey | PLGMVKFHIJNJSB-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |