C7H12N4O3S — CID 61066533
2-pyrazol-1-yl-N-(2-sulfamoylethyl)acetamide (PubChem CID 61066533) has the molecular formula C7H12N4O3S and a molecular weight of 232.26 g/mol. Its IUPAC name is 2-pyrazol-1-yl-N-(2-sulfamoylethyl)acetamide.
| Compound Name | 2-pyrazol-1-yl-N-(2-sulfamoylethyl)acetamide |
|---|---|
| PubChem CID | 61066533 |
| Molecular Formula | C7H12N4O3S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 2-pyrazol-1-yl-N-(2-sulfamoylethyl)acetamide |
| SMILES | NS(=O)(=O)CCNC(=O)Cn1cccn1 |
| InChI | InChI=1S/C7H12N4O3S/c8-15(13,14)5-3-9-7(12)6-11-4-1-2-10-11/h1-2,4H,3,5-6H2,(H,9,12)(H2,8,13,14) |
| InChIKey | LNCFPBTYAFJINB-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |