C7H11N5O5S — CID 66288282
1-[2-oxo-2-(2-sulfamoylethylamino)ethyl]triazole-4-carboxylic acid (PubChem CID 66288282) has the molecular formula C7H11N5O5S and a molecular weight of 277.26 g/mol. Its IUPAC name is 1-[2-oxo-2-(2-sulfamoylethylamino)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-oxo-2-(2-sulfamoylethylamino)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66288282 |
| Molecular Formula | C7H11N5O5S |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 1-[2-oxo-2-(2-sulfamoylethylamino)ethyl]triazole-4-carboxylic acid |
| SMILES | NS(=O)(=O)CCNC(=O)Cn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C7H11N5O5S/c8-18(16,17)2-1-9-6(13)4-12-3-5(7(14)15)10-11-12/h3H,1-2,4H2,(H,9,13)(H,14,15)(H2,8,16,17) |
| InChIKey | OFMPTJWCSUQOFJ-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 157.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |