C6H12N6O3S — CID 61016737
2-(3-amino-1,2,4-triazol-1-yl)-N-(2-sulfamoylethyl)acetamide (PubChem CID 61016737) has the molecular formula C6H12N6O3S and a molecular weight of 248.27 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-N-(2-sulfamoylethyl)acetamide.
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-(2-sulfamoylethyl)acetamide |
|---|---|
| PubChem CID | 61016737 |
| Molecular Formula | C6H12N6O3S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-(2-sulfamoylethyl)acetamide |
| SMILES | Nc1ncn(CC(=O)NCCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C6H12N6O3S/c7-6-10-4-12(11-6)3-5(13)9-1-2-16(8,14)15/h4H,1-3H2,(H2,7,11)(H,9,13)(H2,8,14,15) |
| InChIKey | ISZGZYOUSNOAJY-UHFFFAOYSA-N |
| XLogP | -2.73 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |