C9H17N7O2 — CID 83107218
2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(dimethylcarbamoylamino)ethyl]acetamide (PubChem CID 83107218) has the molecular formula C9H17N7O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(dimethylcarbamoylamino)ethyl]acetamide.
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(dimethylcarbamoylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 83107218 |
| Molecular Formula | C9H17N7O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(dimethylcarbamoylamino)ethyl]acetamide |
| SMILES | CN(C)C(=O)NCCNC(=O)Cn1cnc(N)n1 |
| InChI | InChI=1S/C9H17N7O2/c1-15(2)9(18)12-4-3-11-7(17)5-16-6-13-8(10)14-16/h6H,3-5H2,1-2H3,(H2,10,14)(H,11,17)(H,12,18) |
| InChIKey | NTPMDYLMAJYYDM-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 118.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|