C8H14N6O3 — CID 106233336
N-[2-(2-amino-2-oxoethoxy)ethyl]-2-(3-amino-1,2,4-triazol-1-yl)acetamide (PubChem CID 106233336) has the molecular formula C8H14N6O3 and a molecular weight of 242.24 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethoxy)ethyl]-2-(3-amino-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-2-(3-amino-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 106233336 |
| Molecular Formula | C8H14N6O3 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-2-(3-amino-1,2,4-triazol-1-yl)acetamide |
| SMILES | NC(=O)COCCNC(=O)Cn1cnc(N)n1 |
| InChI | InChI=1S/C8H14N6O3/c9-6(15)4-17-2-1-11-7(16)3-14-5-12-8(10)13-14/h5H,1-4H2,(H2,9,15)(H2,10,13)(H,11,16) |
| InChIKey | HMJQIAHAHHEKKP-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|