C7H10F3N5OS — CID 106425302
2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]acetamide (PubChem CID 106425302) has the molecular formula C7H10F3N5OS and a molecular weight of 269.25 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 106425302 |
| Molecular Formula | C7H10F3N5OS |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]acetamide |
| SMILES | Nc1ncn(CC(=O)NCCSC(F)(F)F)n1 |
| InChI | InChI=1S/C7H10F3N5OS/c8-7(9,10)17-2-1-12-5(16)3-15-4-13-6(11)14-15/h4H,1-3H2,(H2,11,14)(H,12,16) |
| InChIKey | KZRYATNMDSMYBH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|