C12H15N5O2 — CID 55012849
2-(3-amino-1,2,4-triazol-1-yl)-N-(2-phenoxyethyl)acetamide (PubChem CID 55012849) has the molecular formula C12H15N5O2 and a molecular weight of 261.29 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 55012849 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-(2-phenoxyethyl)acetamide |
| SMILES | Nc1ncn(CC(=O)NCCOc2ccccc2)n1 |
| InChI | InChI=1S/C12H15N5O2/c13-12-15-9-17(16-12)8-11(18)14-6-7-19-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H2,13,16)(H,14,18) |
| InChIKey | AMOAJMYDZFPYCQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|