C12H19N5O4 — CID 66288710
1-[2-[[3-(butan-2-ylamino)-3-oxopropyl]amino]-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 66288710) has the molecular formula C12H19N5O4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 1-[2-[[3-(butan-2-ylamino)-3-oxopropyl]amino]-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[[3-(butan-2-ylamino)-3-oxopropyl]amino]-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66288710 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-[2-[[3-(butan-2-ylamino)-3-oxopropyl]amino]-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | CCC(C)NC(=O)CCNC(=O)Cn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C12H19N5O4/c1-3-8(2)14-10(18)4-5-13-11(19)7-17-6-9(12(20)21)15-16-17/h6,8H,3-5,7H2,1-2H3,(H,13,19)(H,14,18)(H,20,21) |
| InChIKey | TYBZKJQHNYUHFF-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |