C10H16N4O4S — CID 113493695
1-[2-(4-methylsulfinylbutan-2-ylamino)-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 113493695) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is 1-[2-(4-methylsulfinylbutan-2-ylamino)-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(4-methylsulfinylbutan-2-ylamino)-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 113493695 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-[2-(4-methylsulfinylbutan-2-ylamino)-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | CC(CCS(C)=O)NC(=O)Cn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C10H16N4O4S/c1-7(3-4-19(2)18)11-9(15)6-14-5-8(10(16)17)12-13-14/h5,7H,3-4,6H2,1-2H3,(H,11,15)(H,16,17) |
| InChIKey | XQOQITAZOYDMFF-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |