C11H18N6O3 — CID 66290153
1-[2-oxo-2-(2-piperazin-1-ylethylamino)ethyl]triazole-4-carboxylic acid (PubChem CID 66290153) has the molecular formula C11H18N6O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 1-[2-oxo-2-(2-piperazin-1-ylethylamino)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-oxo-2-(2-piperazin-1-ylethylamino)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66290153 |
| Molecular Formula | C11H18N6O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-[2-oxo-2-(2-piperazin-1-ylethylamino)ethyl]triazole-4-carboxylic acid |
| SMILES | O=C(Cn1cc(C(=O)O)nn1)NCCN1CCNCC1 |
| InChI | InChI=1S/C11H18N6O3/c18-10(8-17-7-9(11(19)20)14-15-17)13-3-6-16-4-1-12-2-5-16/h7,12H,1-6,8H2,(H,13,18)(H,19,20) |
| InChIKey | XVSVCLRSSSENJW-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |