C9H15N5OS — CID 65216444
N-(2-piperazin-1-ylethyl)thiadiazole-4-carboxamide (PubChem CID 65216444) has the molecular formula C9H15N5OS and a molecular weight of 241.32 g/mol. Its IUPAC name is N-(2-piperazin-1-ylethyl)thiadiazole-4-carboxamide.
| Compound Name | N-(2-piperazin-1-ylethyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 65216444 |
| Molecular Formula | C9H15N5OS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N-(2-piperazin-1-ylethyl)thiadiazole-4-carboxamide |
| SMILES | O=C(NCCN1CCNCC1)c1csnn1 |
| InChI | InChI=1S/C9H15N5OS/c15-9(8-7-16-13-12-8)11-3-6-14-4-1-10-2-5-14/h7,10H,1-6H2,(H,11,15) |
| InChIKey | FQKWRSUADADNBC-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |