C11H17N3OS2 — CID 107024051
N-(2-piperazin-1-ylethyl)-4-sulfanylthiophene-2-carboxamide (PubChem CID 107024051) has the molecular formula C11H17N3OS2 and a molecular weight of 271.41 g/mol. Its IUPAC name is N-(2-piperazin-1-ylethyl)-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-(2-piperazin-1-ylethyl)-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107024051 |
| Molecular Formula | C11H17N3OS2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-(2-piperazin-1-ylethyl)-4-sulfanylthiophene-2-carboxamide |
| SMILES | O=C(NCCN1CCNCC1)c1cc(S)cs1 |
| InChI | InChI=1S/C11H17N3OS2/c15-11(10-7-9(16)8-17-10)13-3-6-14-4-1-12-2-5-14/h7-8,12,16H,1-6H2,(H,13,15) |
| InChIKey | FGXBLEDWTDDIGK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|