C12H20N4O3S2 — CID 119448759
4-(methylsulfamoyl)-N-(2-piperazin-1-ylethyl)thiophene-2-carboxamide (PubChem CID 119448759) has the molecular formula C12H20N4O3S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-(methylsulfamoyl)-N-(2-piperazin-1-ylethyl)thiophene-2-carboxamide.
| Compound Name | 4-(methylsulfamoyl)-N-(2-piperazin-1-ylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119448759 |
| Molecular Formula | C12H20N4O3S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 4-(methylsulfamoyl)-N-(2-piperazin-1-ylethyl)thiophene-2-carboxamide |
| SMILES | CNS(=O)(=O)c1csc(C(=O)NCCN2CCNCC2)c1 |
| InChI | InChI=1S/C12H20N4O3S2/c1-13-21(18,19)10-8-11(20-9-10)12(17)15-4-7-16-5-2-14-3-6-16/h8-9,13-14H,2-7H2,1H3,(H,15,17) |
| InChIKey | SLHUMRHUTZLZNB-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |