C8H11N3O2S2 — CID 107034097
N-[2-(carbamoylamino)ethyl]-4-sulfanylthiophene-2-carboxamide (PubChem CID 107034097) has the molecular formula C8H11N3O2S2 and a molecular weight of 245.33 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107034097 |
| Molecular Formula | C8H11N3O2S2 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-4-sulfanylthiophene-2-carboxamide |
| SMILES | NC(=O)NCCNC(=O)c1cc(S)cs1 |
| InChI | InChI=1S/C8H11N3O2S2/c9-8(13)11-2-1-10-7(12)6-3-5(14)4-15-6/h3-4,14H,1-2H2,(H,10,12)(H3,9,11,13) |
| InChIKey | OQOSFGOAUHOVMT-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|