C10H13NO2S2 — CID 107031671
N-[(3-hydroxycyclobutyl)methyl]-4-sulfanylthiophene-2-carboxamide (PubChem CID 107031671) has the molecular formula C10H13NO2S2 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)methyl]-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-[(3-hydroxycyclobutyl)methyl]-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107031671 |
| Molecular Formula | C10H13NO2S2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)methyl]-4-sulfanylthiophene-2-carboxamide |
| SMILES | O=C(NCC1CC(O)C1)c1cc(S)cs1 |
| InChI | InChI=1S/C10H13NO2S2/c12-7-1-6(2-7)4-11-10(13)9-3-8(14)5-15-9/h3,5-7,12,14H,1-2,4H2,(H,11,13) |
| InChIKey | MSRWAHPIAUHZSB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|