C12H18N2OS2 — CID 107021324
N-[(1-ethylpyrrolidin-2-yl)methyl]-4-sulfanylthiophene-2-carboxamide (PubChem CID 107021324) has the molecular formula C12H18N2OS2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107021324 |
| Molecular Formula | C12H18N2OS2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-4-sulfanylthiophene-2-carboxamide |
| SMILES | CCN1CCCC1CNC(=O)c1cc(S)cs1 |
| InChI | InChI=1S/C12H18N2OS2/c1-2-14-5-3-4-9(14)7-13-12(15)11-6-10(16)8-17-11/h6,8-9,16H,2-5,7H2,1H3,(H,13,15) |
| InChIKey | VLKOUTUKHMJXIP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|