C10H22N2OS — CID 143677911
N-[(1-ethylpyrrolidin-2-yl)methyl]acetamide;methanethiol (PubChem CID 143677911) has the molecular formula C10H22N2OS and a molecular weight of 218.37 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]acetamide;methanethiol.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]acetamide;methanethiol |
|---|---|
| PubChem CID | 143677911 |
| Molecular Formula | C10H22N2OS |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]acetamide;methanethiol |
| SMILES | CCN1CCCC1CNC(C)=O.CS |
| InChI | InChI=1S/C9H18N2O.CH4S/c1-3-11-6-4-5-9(11)7-10-8(2)12;1-2/h9H,3-7H2,1-2H3,(H,10,12);2H,1H3 |
| InChIKey | NOSXIZHHYCTWEC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|