C13H25N3O2 — CID 7320188
N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-N'-(2-methylpropyl)oxamide (PubChem CID 7320188) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-N'-(2-methylpropyl)oxamide.
| Compound Name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-N'-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 7320188 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-N'-(2-methylpropyl)oxamide |
| SMILES | CCN1CCC[C@H]1CNC(=O)C(=O)NCC(C)C |
| InChI | InChI=1S/C13H25N3O2/c1-4-16-7-5-6-11(16)9-15-13(18)12(17)14-8-10(2)3/h10-11H,4-9H2,1-3H3,(H,14,17)(H,15,18)/t11-/m0/s1 |
| InChIKey | KWYZBVJPGJEZEK-NSHDSACASA-N |
| XLogP | 0.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|