C10H22N2O — CID 159182126
N-[(1-ethylpyrrolidin-2-yl)methyl]acetamide;methane (PubChem CID 159182126) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]acetamide;methane.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]acetamide;methane |
|---|---|
| PubChem CID | 159182126 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]acetamide;methane |
| SMILES | C.CCN1CCCC1CNC(C)=O |
| InChI | InChI=1S/C9H18N2O.CH4/c1-3-11-6-4-5-9(11)7-10-8(2)12;/h9H,3-7H2,1-2H3,(H,10,12);1H4 |
| InChIKey | KNAMLXPHGMOZCL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |