C12H20Cl2N2O — CID 98681847
(1R)-2,2-dichloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 98681847) has the molecular formula C12H20Cl2N2O and a molecular weight of 279.21 g/mol. Its IUPAC name is (1R)-2,2-dichloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 98681847 |
| Molecular Formula | C12H20Cl2N2O |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | (1R)-2,2-dichloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | CCN1CCC[C@H]1CNC(=O)[C@@]1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C12H20Cl2N2O/c1-3-16-6-4-5-9(16)7-15-10(17)11(2)8-12(11,13)14/h9H,3-8H2,1-2H3,(H,15,17)/t9-,11+/m0/s1 |
| InChIKey | DDQFQSPRARYEBE-GXSJLCMTSA-N |
| XLogP | 2.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|