C13H25N3S — CID 43414187
N-[(1-ethylpyrrolidin-2-yl)methyl]piperidine-1-carbothioamide (PubChem CID 43414187) has the molecular formula C13H25N3S and a molecular weight of 255.43 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]piperidine-1-carbothioamide.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 43414187 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]piperidine-1-carbothioamide |
| SMILES | CCN1CCCC1CNC(=S)N1CCCCC1 |
| InChI | InChI=1S/C13H25N3S/c1-2-15-10-6-7-12(15)11-14-13(17)16-8-4-3-5-9-16/h12H,2-11H2,1H3,(H,14,17) |
| InChIKey | UCMHETGOUKOBGC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|