C15H27N3S — CID 124832368
1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]thiourea (PubChem CID 124832368) has the molecular formula C15H27N3S and a molecular weight of 281.47 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]thiourea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 124832368 |
| Molecular Formula | C15H27N3S |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]thiourea |
| SMILES | CCN1CCC[C@@H]1CNC(=S)N[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C15H27N3S/c1-2-18-7-3-4-13(18)10-16-15(19)17-14-9-11-5-6-12(14)8-11/h11-14H,2-10H2,1H3,(H2,16,17,19)/t11-,12-,13+,14-/m0/s1 |
| InChIKey | CVCKAVFQRQANQO-FQUUOJAGSA-N |
| XLogP | 2.12 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|