C13H23N3S — CID 98752058
1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-piperidin-1-ylthiourea (PubChem CID 98752058) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-piperidin-1-ylthiourea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-piperidin-1-ylthiourea |
|---|---|
| PubChem CID | 98752058 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-piperidin-1-ylthiourea |
| SMILES | S=C(N[C@H]1C[C@H]2CC[C@H]1C2)NN1CCCCC1 |
| InChI | InChI=1S/C13H23N3S/c17-13(15-16-6-2-1-3-7-16)14-12-9-10-4-5-11(12)8-10/h10-12H,1-9H2,(H2,14,15,17)/t10-,11-,12-/m0/s1 |
| InChIKey | ILXUVOVZTQKKCY-SRVKXCTJSA-N |
| XLogP | 2.04 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|