C12H19N3S3 — CID 18389083
1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[(1S,4S)-2,5-dithia-7-azabicyclo[2.2.1]heptan-7-yl]thiourea (PubChem CID 18389083) has the molecular formula C12H19N3S3 and a molecular weight of 301.51 g/mol. Its IUPAC name is 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[(1S,4S)-2,5-dithia-7-azabicyclo[2.2.1]heptan-7-yl]thiourea.
| Compound Name | 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[(1S,4S)-2,5-dithia-7-azabicyclo[2.2.1]heptan-7-yl]thiourea |
|---|---|
| PubChem CID | 18389083 |
| Molecular Formula | C12H19N3S3 |
| Molecular Weight | 301.51 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[(1S,4S)-2,5-dithia-7-azabicyclo[2.2.1]heptan-7-yl]thiourea |
| SMILES | S=C(N[C@H]1C[C@@H]2CC[C@@H]1C2)NN1[C@@H]2CS[C@H]1CS2 |
| InChI | InChI=1S/C12H19N3S3/c16-12(13-9-4-7-1-2-8(9)3-7)14-15-10-5-17-11(15)6-18-10/h7-11H,1-6H2,(H2,13,14,16)/t7-,8-,9+,10+,11+/m1/s1 |
| InChIKey | JZDHPZNXRLWACF-UVOCVTCTSA-N |
| XLogP | 2.00 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|