C11H15NOS2 — CID 107022608
N-(cyclopentylmethyl)-4-sulfanylthiophene-2-carboxamide (PubChem CID 107022608) has the molecular formula C11H15NOS2 and a molecular weight of 241.38 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-(cyclopentylmethyl)-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107022608 |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | N-(cyclopentylmethyl)-4-sulfanylthiophene-2-carboxamide |
| SMILES | O=C(NCC1CCCC1)c1cc(S)cs1 |
| InChI | InChI=1S/C11H15NOS2/c13-11(10-5-9(14)7-15-10)12-6-8-3-1-2-4-8/h5,7-8,14H,1-4,6H2,(H,12,13) |
| InChIKey | AKRSAJJXDPEWRJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|