C12H15Br2NOS — CID 78906806
4,5-dibromo-N-(cyclohexylmethyl)thiophene-2-carboxamide (PubChem CID 78906806) has the molecular formula C12H15Br2NOS and a molecular weight of 381.13 g/mol. Its IUPAC name is 4,5-dibromo-N-(cyclohexylmethyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(cyclohexylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78906806 |
| Molecular Formula | C12H15Br2NOS |
| Molecular Weight | 381.13 g/mol |
| Exact Mass | 378.92 |
| IUPAC Name | 4,5-dibromo-N-(cyclohexylmethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCC1CCCCC1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H15Br2NOS/c13-9-6-10(17-11(9)14)12(16)15-7-8-4-2-1-3-5-8/h6,8H,1-5,7H2,(H,15,16) |
| InChIKey | UUWMDGHZAJMLHI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.13 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |