C11H14Br2N2OS — CID 80537490
4,5-dibromo-N-(piperidin-2-ylmethyl)thiophene-2-carboxamide (PubChem CID 80537490) has the molecular formula C11H14Br2N2OS and a molecular weight of 382.12 g/mol. Its IUPAC name is 4,5-dibromo-N-(piperidin-2-ylmethyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(piperidin-2-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 80537490 |
| Molecular Formula | C11H14Br2N2OS |
| Molecular Weight | 382.12 g/mol |
| Exact Mass | 379.92 |
| IUPAC Name | 4,5-dibromo-N-(piperidin-2-ylmethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCC1CCCCN1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H14Br2N2OS/c12-8-5-9(17-10(8)13)11(16)15-6-7-3-1-2-4-14-7/h5,7,14H,1-4,6H2,(H,15,16) |
| InChIKey | NXKFPWBPTLXSLA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.12 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |