C10H12BrNOS — CID 33372780
5-bromo-N-(cyclobutylmethyl)thiophene-2-carboxamide (PubChem CID 33372780) has the molecular formula C10H12BrNOS and a molecular weight of 274.18 g/mol. Its IUPAC name is 5-bromo-N-(cyclobutylmethyl)thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(cyclobutylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 33372780 |
| Molecular Formula | C10H12BrNOS |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 5-bromo-N-(cyclobutylmethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCC1CCC1)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H12BrNOS/c11-9-5-4-8(14-9)10(13)12-6-7-2-1-3-7/h4-5,7H,1-3,6H2,(H,12,13) |
| InChIKey | PEDKJBRUHQIQAE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |