C10H9BrN4O3S — CID 66289559
1-[2-[(5-bromothiophen-2-yl)methylamino]-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 66289559) has the molecular formula C10H9BrN4O3S and a molecular weight of 345.18 g/mol. Its IUPAC name is 1-[2-[(5-bromothiophen-2-yl)methylamino]-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(5-bromothiophen-2-yl)methylamino]-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66289559 |
| Molecular Formula | C10H9BrN4O3S |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | 1-[2-[(5-bromothiophen-2-yl)methylamino]-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | O=C(Cn1cc(C(=O)O)nn1)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C10H9BrN4O3S/c11-8-2-1-6(19-8)3-12-9(16)5-15-4-7(10(17)18)13-14-15/h1-2,4H,3,5H2,(H,12,16)(H,17,18) |
| InChIKey | QMNFXESHQHEWJV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |