C12H14BrNO5S — CID 61237488
oxolan-3-ylmethyl 2-bromo-5-sulfamoylbenzoate (PubChem CID 61237488) has the molecular formula C12H14BrNO5S and a molecular weight of 364.22 g/mol. Its IUPAC name is oxolan-3-ylmethyl 2-bromo-5-sulfamoylbenzoate.
| Compound Name | oxolan-3-ylmethyl 2-bromo-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 61237488 |
| Molecular Formula | C12H14BrNO5S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | oxolan-3-ylmethyl 2-bromo-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(Br)c(C(=O)OCC2CCOC2)c1 |
| InChI | InChI=1S/C12H14BrNO5S/c13-11-2-1-9(20(14,16)17)5-10(11)12(15)19-7-8-3-4-18-6-8/h1-2,5,8H,3-4,6-7H2,(H2,14,16,17) |
| InChIKey | YBIVNSXBZPACRA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |